| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:08:59 UTC |
|---|
| Update Date | 2025-03-21 18:30:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00083739 |
|---|
| Frequency | 34.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12O8S |
|---|
| Molecular Mass | 244.0253 |
|---|
| SMILES | O=C(CCC(O)CO)OCOS(=O)(=O)O |
|---|
| InChI Key | CBUKBRSMGVZODY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | fatty acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfatescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesprimary alcoholssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholaliphatic acyclic compoundsulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativescarboxylic acid derivativefatty acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteralkyl sulfatesecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterprimary alcoholorganooxygen compound1,2-diol |
|---|