| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:08:59 UTC |
|---|
| Update Date | 2025-03-21 18:30:58 UTC |
|---|
| HMDB ID | HMDB0251166 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00083745 |
|---|
| Name | Dibenzoylmethane |
|---|
| Frequency | 34.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O2 |
|---|
| Molecular Mass | 224.0837 |
|---|
| SMILES | O=C(CC(=O)c1ccccc1)c1ccccc1 |
|---|
| InChI Key | NZZIMKJIVMHWJC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | retro-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenoneshydrocarbon derivativeslinear 1,3-diarylpropanoidsorganic oxidesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonebenzoylretro-dihydrochalconephenylketoneketonebutyrophenonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
