| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:08 UTC |
|---|
| Update Date | 2025-03-21 18:31:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00084102 |
|---|
| Frequency | 34.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20NO2+ |
|---|
| Molecular Mass | 210.1489 |
|---|
| SMILES | CC(Cc1ccc(O)c(O)c1)[N+](C)(C)C |
|---|
| InChI Key | FMBGOFQDWPTPAZ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsamineshydrocarbon derivativesorganic cationsorganic saltsorganooxygen compoundsorganopnictogen compoundsphenylpropanestetraalkylammonium salts |
|---|
| Substituents | tetraalkylammonium saltquaternary ammonium salt1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphenylpropanearomatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineamphetamine or derivativesorganooxygen compound |
|---|
