| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:11 UTC |
|---|
| Update Date | 2025-03-21 18:31:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00084196 |
|---|
| Frequency | 34.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18O13S |
|---|
| Molecular Mass | 450.0468 |
|---|
| SMILES | COc1cc(C=CC(=O)OC2OC(C(=O)O)C(O)C(O)C2OS(=O)(=O)O)ccc1O |
|---|
| InChI Key | CCHOQEFTKILQPJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoidsacetalsalkyl aryl ethersalkyl sulfatesanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesenoate estersfatty acid estersglucuronic acid derivativeshydrocarbon derivativeshydroxycinnamic acidsmethoxybenzenesmethoxyphenolsmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acido-glucuronidemethoxyphenolmonosaccharidepyran carboxylic acid1-o-glucuronidealpha,beta-unsaturated carboxylic esterbeta-hydroxy acidacetaloxaneorganoheterocyclic compound1,2-diolenoate esteralcoholmethoxybenzenefatty acid esteranisolecarboxylic acid esterdicarboxylic acid or derivativesphenolhydrocarbon derivativephenoxy compoundfatty acylcarbonyl groupsulfuric acid monoesteretheraromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativehydroxycinnamic acid or derivativescinnamic acid or derivativesorganic oxidealkyl sulfatepyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshydroxy acidhydroxycinnamic acidoxacyclepyransecondary alcoholsulfate-esterbenzenoidsulfuric acid ester |
|---|