| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:23 UTC |
|---|
| Update Date | 2025-03-21 18:31:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00084651 |
|---|
| Frequency | 33.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16N2OS |
|---|
| Molecular Mass | 248.0983 |
|---|
| SMILES | O=C1NC2CSC(CCc3ccccc3)C2N1 |
|---|
| InChI Key | SOPMCSMBSLXFMB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thienoimidazolidines |
|---|
| Subclass | thienoimidazolidines |
|---|
| Direct Parent | thienoimidazolidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbonyl compoundsdialkylthioethershydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinemonocyclic benzene moietycarbonyl groupcarbonic acid derivativeazacycledialkylthioetherthienoimidazolidinethiopheneimidazolidinoneorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
