| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:25 UTC |
|---|
| Update Date | 2025-03-21 18:31:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00084720 |
|---|
| Frequency | 33.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H9ClO5 |
|---|
| Molecular Mass | 304.0139 |
|---|
| SMILES | O=c1cc(-c2ccc(O)c(Cl)c2)oc2cc(O)cc(O)c12 |
|---|
| InChI Key | NOMQTUMUWFATLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids7-hydroxyflavonoidsaryl chlorideschlorobenzeneschromonesflavonoidshalophenolsheteroaromatic compoundshydrocarbon derivativeso-chlorophenolsorganic oxidesorganochloridesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety1-benzopyranorganochloride1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundaryl chloride2-chlorophenolchlorobenzenebenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidaryl halide2-halophenoloxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compound |
|---|