| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:29 UTC |
|---|
| Update Date | 2025-03-21 18:31:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00084903 |
|---|
| Frequency | 33.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9NO4 |
|---|
| Molecular Mass | 231.0532 |
|---|
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccco1 |
|---|
| InChI Key | KGUJFARQLOGYHU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | 2-furanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds2-heteroaryl carboxamidesbenzoic acidsbenzoyl derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | furancarboxylic acidaromatic heteromonocyclic compoundbenzoylcarboxylic acid derivative2-heteroaryl carboxamideorganic oxide2-furanilideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidorganoheterocyclic compoundvinylogous amidefuroic acid or derivativesheteroaromatic compoundbenzoic acid or derivativescarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
