| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:31 UTC |
|---|
| Update Date | 2025-03-21 18:31:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00084981 |
|---|
| Frequency | 33.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N5O12P3 |
|---|
| Molecular Mass | 491.0008 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1CC(OP(=O)(O)OP(=O)(O)O)C(COP(=O)(O)O)O1 |
|---|
| InChI Key | YSHGIVAHDFLLLN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine deoxyribonucleotides |
|---|
| Direct Parent | purine deoxyribonucleoside 3',5'-bisphosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-substituted imidazolesorganic oxidesorganic pyrophosphatesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativesribonucleoside 3'-phosphatestetrahydrofurans |
|---|
| Substituents | imidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazolen-substituted imidazoleribonucleoside 3'-phosphateazacycletetrahydrofuranheteroaromatic compoundorganic pyrophosphatepurine deoxyribonucleoside 3',5'-bisphosphateoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativepurineprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|