| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:38 UTC |
|---|
| Update Date | 2025-03-21 18:31:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00085267 |
|---|
| Frequency | 33.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O5S |
|---|
| Molecular Mass | 320.0718 |
|---|
| SMILES | CSc1cc(O)cc2c1CC(O)C(c1ccc(O)c(O)c1)O2 |
|---|
| InChI Key | XCQPKZSNOWFISB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersalkylarylthioethersbenzene and substituted derivativesflavan-3-olshydrocarbon derivativesoxacyclic compoundssecondary alcoholssulfenyl compoundsthiophenol ethersthiophenols |
|---|
| Substituents | monocyclic benzene moiety3-hydroxyflavonoidether1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheralkylarylthioetherorganosulfur compoundaryl thioetherthiophenolaromatic heteropolycyclic compoundthiophenol etherchromaneflavan-3-olorganoheterocyclic compoundalcoholbenzopyransulfenyl compound1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compoundthioether7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|