| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:38 UTC |
|---|
| Update Date | 2025-03-21 18:31:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00085268 |
|---|
| Frequency | 33.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O5 |
|---|
| Molecular Mass | 222.0528 |
|---|
| SMILES | O=C(O)CC(=O)OC(=O)Cc1ccccc1 |
|---|
| InChI Key | VKOJJGOOFTYSPB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboxylic acid anhydridescarboxylic acidshydrocarbon derivativesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidtricarboxylic acid or derivativesaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid anhydridehydrocarbon derivativebenzenoidorganooxygen compound |
|---|