| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:41 UTC |
|---|
| Update Date | 2025-03-21 18:31:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00085391 |
|---|
| Frequency | 33.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11NO10P2 |
|---|
| Molecular Mass | 306.9858 |
|---|
| SMILES | NC(CCC(=O)OP(=O)(O)OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | YUTAQFJPRDQPML-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl phosphatesalpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesorganic oxidesorganic phosphoric acids and derivativesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty acidglutamic acid or derivativesorganic pyrophosphateorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
