| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:43 UTC |
|---|
| Update Date | 2025-03-21 18:31:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00085464 |
|---|
| Frequency | 33.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15NO |
|---|
| Molecular Mass | 177.1154 |
|---|
| SMILES | [O-][n+]1cccc(C2CCCCC2)c1 |
|---|
| InChI Key | VNSKXTGITIFGEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridines and derivatives |
|---|
| Direct Parent | pyridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | organic oxidepyridineorganic oxygen compoundaromatic heteromonocyclic compoundazacycleheteroaromatic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
