| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:47 UTC |
|---|
| Update Date | 2025-03-21 18:31:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00085633 |
|---|
| Frequency | 64.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO8 |
|---|
| Molecular Mass | 293.1111 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(O)C(O)C1OC(C)C(=O)O |
|---|
| InChI Key | IGIURAGMBPHGSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acidscyclitols and derivativesdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupethercarboxylic acidcyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupcarboxylic acid derivativedialkyl ethersecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundacetamide |
|---|