| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:52 UTC |
|---|
| Update Date | 2025-03-21 18:31:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00085808 |
|---|
| Frequency | 47.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15N3O5 |
|---|
| Molecular Mass | 269.1012 |
|---|
| SMILES | O=C(NC(Cc1c[nH]cn1)C(=O)O)OC1CCOC1 |
|---|
| InChI Key | BZVDOOYSBBQWKD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbamate esterscarbonyl compoundscarboxylic acidsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidazolesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | carbonyl groupethercarboxylic acidaromatic heteromonocyclic compounddialkyl etherorganic oxideimidazoleorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazolecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundcarbamic acid esteroxacyclemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
