| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:57 UTC |
|---|
| Update Date | 2025-03-21 18:31:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086007 |
|---|
| Frequency | 33.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O8S |
|---|
| Molecular Mass | 354.0409 |
|---|
| SMILES | O=S(=O)(O)c1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2 |
|---|
| InChI Key | VEUVGJIXRCIJNL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids1-sulfo,2-unsubstituted aromatic compounds3'-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoidsalkyl aryl ethersarylsulfonic acids and derivativesbenzene and substituted derivativesflavan-3-olshydrocarbon derivativesorganic oxidesorganosulfonic acidsoxacyclic compoundssecondary alcoholssulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyranflavanorganosulfonic acid1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganosulfur compoundorganic oxidearomatic heteropolycyclic compoundchromaneflavan-3-olorganoheterocyclic compoundalcoholbenzopyran1-sulfo,2-unsubstituted aromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclesulfonylorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativessecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|