| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:57 UTC |
|---|
| Update Date | 2025-03-21 18:31:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086013 |
|---|
| Frequency | 33.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O5 |
|---|
| Molecular Mass | 260.0685 |
|---|
| SMILES | O=C(c1c(O)cc(O)cc1O)C(O)c1ccccc1 |
|---|
| InChI Key | OCBUWESJQKROOT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | benzoins |
|---|
| Direct Parent | benzoins |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacyloinsacylphloroglucinols and derivativesalkyl-phenylketonesaromatic alcoholsaryl alkyl ketonesbenzoyl derivativeshydrocarbon derivativesorganic oxidessecondary alcoholsvinylogous acids |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietyaryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidketonephloroglucinol derivativeorganic oxideacylphloroglucinol derivativealcoholbenzoinbenzenetriol1-hydroxy-4-unsubstituted benzenoidphenylketonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundacyloinsecondary alcoholphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|