| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:09:59 UTC |
|---|
| Update Date | 2025-03-21 18:31:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086068 |
|---|
| Frequency | 33.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H23NO4 |
|---|
| Molecular Mass | 317.1627 |
|---|
| SMILES | CN1CC2CC(OC(=O)C(CO)c3ccccc3)CC1C1OC21 |
|---|
| InChI Key | VRWDFJIJUBJGMV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | epoxypiperidines |
|---|
| Subclass | epoxypiperidines |
|---|
| Direct Parent | epoxypiperidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-oxazepinesamino acids and derivativesazacyclic compoundsazepanesbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid estersdialkyl ethersepoxideshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundspiperidinesprimary alcoholstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupetheramino acid or derivativescarboxylic acid derivativedialkyl etherbeta-hydroxy acidorganic oxideepoxypiperidinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholpiperidinetertiary aminealcoholazacycletertiary aliphatic amineoxiranehydroxy acidpara-oxazepineoxacyclemonocarboxylic acid or derivativesazepaneorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
