| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:10:01 UTC |
|---|
| Update Date | 2025-03-21 18:31:30 UTC |
|---|
| HMDB ID | HMDB0130767 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086167 |
|---|
| Name | 3-(4-hydroxyphenyl)-5,7-dimethoxy-4H-chromen-4-one |
|---|
| Frequency | 33.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O5 |
|---|
| Molecular Mass | 298.0841 |
|---|
| SMILES | COc1cc(OC)c2c(=O)c(-c3ccc(O)cc3)coc2c1 |
|---|
| InChI Key | YZBVKMUAJDLNMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | o-methylated isoflavonoids |
|---|
| Direct Parent | 7-o-methylisoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesisoflavonoidsorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous esters |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compound7-o-methylisoflavoneisoflavonebenzopyranvinylogous esterheteroaromatic compoundoxacycleorganic oxygen compoundpyrananisolephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
