| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:05 UTC |
|---|
| Update Date | 2025-03-21 18:31:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086304 |
|---|
| Frequency | 33.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N2O3 |
|---|
| Molecular Mass | 208.0848 |
|---|
| SMILES | CNC(=O)CC(=O)c1cccc(O)c1N |
|---|
| InChI Key | MCKVBQXIHTXTEN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsamino acids and derivativesaryl alkyl ketonesbenzoyl derivativescarboxylic acids and derivativesfatty amideshydrocarbon derivativesorganic oxidesorganopnictogen compoundsprimary aminessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | fatty acylmonocyclic benzene moietyaryl alkyl ketoneamino acid or derivativesfatty amidebenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amide1-hydroxy-4-unsubstituted benzenoidcarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amidephenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketone |
|---|