| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:14 UTC |
|---|
| Update Date | 2025-03-21 18:31:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086654 |
|---|
| Frequency | 32.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12NO5P |
|---|
| Molecular Mass | 245.0453 |
|---|
| SMILES | NC(Cc1ccc(P(=O)(O)O)cc1)C(=O)O |
|---|
| InChI Key | DGIHNAYKZDFPPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganonitrogen compoundsorganophosphorus compoundsorganopnictogen compoundsphenylpropanoic acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganophosphonic acid derivativeorganooxygen compoundamphetamine or derivatives |
|---|