| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:10:15 UTC |
|---|
| Update Date | 2025-03-21 18:31:36 UTC |
|---|
| HMDB ID | HMDB0256472 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086677 |
|---|
| Name | Phosphocitrate |
|---|
| Frequency | 32.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9O10P |
|---|
| Molecular Mass | 271.9933 |
|---|
| SMILES | O=C(O)CC(CC(=O)O)(OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | XTRHYDMWPCTCKN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidtricarboxylic acid or derivativesorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
