| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:10:17 UTC |
|---|
| Update Date | 2025-03-21 18:31:37 UTC |
|---|
| HMDB ID | HMDB0136745 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086760 |
|---|
| Name | 3,4,5-trihydroxy-6-[(2-oxo-2H-chromen-5-yl)oxy]oxane-2-carboxylic acid |
|---|
| Frequency | 32.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O9 |
|---|
| Molecular Mass | 338.0638 |
|---|
| SMILES | O=C(O)C1OC(Oc2cccc3oc(=O)ccc23)C(O)C(O)C1O |
|---|
| InChI Key | ZKUCPWSAMRXCKM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarin glycosides |
|---|
| Direct Parent | coumarin glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransacetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyran carboxylic acidspyranones and derivativessecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidglucuronic acid or derivativescoumarin-5-o-glycosidecoumarin o-glycoside1-benzopyrano-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidlactone1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneoxaneorganoheterocyclic compoundalcoholbenzopyranpyran carboxylic acid or derivativesheteroaromatic compoundhydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|