| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:22 UTC |
|---|
| Update Date | 2025-03-21 18:31:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00086953 |
|---|
| Frequency | 32.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13NO4 |
|---|
| Molecular Mass | 199.0845 |
|---|
| SMILES | O=C(O)C1CC2CCN1C(C(=O)O)C2 |
|---|
| InChI Key | IBOPGYQDTUEEAA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundspiperidinecarboxylic acidspiperidinesquinuclidinestrialkylamines |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acidquinuclidinealiphatic heteropolycyclic compoundorganic oxidealpha-amino acidorganonitrogen compoundorganopnictogen compoundpiperidinecarboxylic acidpiperidinetertiary amineorganoheterocyclic compoundazacycletertiary aliphatic amineorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
