| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:10:25 UTC |
|---|
| Update Date | 2025-03-21 18:31:40 UTC |
|---|
| HMDB ID | HMDB0247358 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087052 |
|---|
| Name | 5-(4-Hydroxybenzyl)thiazolidine-2,4-dione |
|---|
| Frequency | 40.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO3S |
|---|
| Molecular Mass | 223.0303 |
|---|
| SMILES | O=C1NC(=O)C(Cc2ccc(O)cc2)S1 |
|---|
| InChI Key | NKOHRVBBQISBSB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | thiazolidines |
|---|
| Direct Parent | thiazolidinediones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthiazolidinesthiolactones |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacycle1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativethiazolidinedioneorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoiddicarboximideorganic nitrogen compoundthiolactoneorganooxygen compound |
|---|
