| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:27 UTC |
|---|
| Update Date | 2025-03-21 18:31:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087149 |
|---|
| Frequency | 32.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N5O8P |
|---|
| Molecular Mass | 361.0423 |
|---|
| SMILES | Nc1nc2c(ncn2C2OC3OP(=O)(O)OC3C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | SOHHJJVFZRLLSS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsoxanesprimary aminespurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactammonosaccharidepyrimidonepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundoxaneazole1,2-dioln-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|