| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:31 UTC |
|---|
| Update Date | 2025-03-21 18:31:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087293 |
|---|
| Frequency | 32.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H14NO9P |
|---|
| Molecular Mass | 275.0406 |
|---|
| SMILES | NC(COP(=O)(O)O)C(O)C(O)C(O)C(=O)O |
|---|
| InChI Key | NFFLHFLCSFVONX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdelta lactamshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmonoalkyl phosphatesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminespiperidinonessecondary alcohols |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidefatty acidmedium-chain hydroxy acidphosphoethanolaminebeta-hydroxy acidsaccharideorganic oxideorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativespiperidinonemedium-chain fatty acidhydroxy fatty acidalcoholhydroxy aciddelta-lactammonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
