| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:33 UTC |
|---|
| Update Date | 2025-03-21 18:31:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087355 |
|---|
| Frequency | 32.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20N2O |
|---|
| Molecular Mass | 256.1576 |
|---|
| SMILES | CN(C)CCC(O)(c1ccccc1)c1cccnc1 |
|---|
| InChI Key | AJAPAGFKJYVVSD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | hydroxypyridines |
|---|
| Direct Parent | hydroxypyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsaromatic alcoholsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesmethylpyridinesorganopnictogen compoundstertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moiety1,3-aminoalcoholaromatic heteromonocyclic compoundazacycleheteroaromatic compoundtertiary aliphatic aminehydroxypyridinemethylpyridinetertiary alcoholorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
