| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-21 00:10:33 UTC |
|---|
| Update Date | 2025-03-21 18:31:44 UTC |
|---|
| HMDB ID | HMDB0001511 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087361 |
|---|
| Name | Phosphocreatine |
|---|
| Frequency | 32.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H10N3O5P |
|---|
| Molecular Mass | 211.0358 |
|---|
| SMILES | CN(CC(=O)O)C(N)=NP(=O)(O)O |
|---|
| InChI Key | DRBBFCLWYRJSJZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsguanidineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidguanidineorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
