| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:33 UTC |
|---|
| Update Date | 2025-03-21 18:31:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087362 |
|---|
| Frequency | 32.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N3O7P |
|---|
| Molecular Mass | 305.0413 |
|---|
| SMILES | Nc1ccn(C2C(O)OC3COP(=O)(O)OC32)c(=O)n1 |
|---|
| InChI Key | ILOURGFVHUFVIX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundshemiacetalsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminestetrahydrofurans |
|---|
| Substituents | carbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundpyrimidoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamorganic phosphoric acid derivativeamineorganooxygen compound |
|---|