| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:39 UTC |
|---|
| Update Date | 2025-03-21 18:31:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087595 |
|---|
| Frequency | 32.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H16O13 |
|---|
| Molecular Mass | 464.0591 |
|---|
| SMILES | O=C(O)C1OC(Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)OC(O)C1O |
|---|
| InChI Key | IZFHLVBDFSKTCO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanes1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidschromonesflavonoidshemiacetalsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesortho estersoxacyclic compoundspyranones and derivativessecondary alcoholsvinylogous acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid1-benzopyranortho ester1-hydroxy-2-unsubstituted benzenoidcarboxylic acid orthoestercarboxylic acid derivativebeta-hydroxy acidorganic oxidechromonearomatic heteropolycyclic compoundpyranonehemiacetalorthocarboxylic acid derivativeorganoheterocyclic compoundalcoholbenzopyranheteroaromatic compound5-hydroxyflavonoidhydroxy acid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundpyran7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidmeta-dioxaneorganooxygen compound |
|---|
