| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:40 UTC |
|---|
| Update Date | 2025-03-21 18:31:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087616 |
|---|
| Frequency | 32.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12NO5P |
|---|
| Molecular Mass | 245.0453 |
|---|
| SMILES | COP(=O)(O)Oc1ccc(CC(N)=O)cc1 |
|---|
| InChI Key | YYCPHAARWRGTLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupcarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphateorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganic phosphoric acid derivativephenylacetamidealkyl phosphateorganooxygen compound |
|---|
