| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:40 UTC |
|---|
| Update Date | 2025-03-21 18:31:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087630 |
|---|
| Frequency | 32.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10N2O3 |
|---|
| Molecular Mass | 206.0691 |
|---|
| SMILES | O=C1CC(c2ccc(O)cc2)NC(=O)N1 |
|---|
| InChI Key | XLTBIZDGIUTDEU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdiazinanesdicarboximideshydrocarbon derivativesn-acyl ureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | n-acyl ureamonocyclic benzene moietycarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacycle1-hydroxy-2-unsubstituted benzenoidpyrimidonecarboxylic acid derivative1,3-diazinaneorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoiddicarboximideorganic nitrogen compoundureideorganooxygen compound |
|---|