| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:41 UTC |
|---|
| Update Date | 2025-03-21 18:31:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087659 |
|---|
| Frequency | 32.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16N2O |
|---|
| Molecular Mass | 240.1263 |
|---|
| SMILES | Nc1ccccc1C(=O)C(N)Cc1ccccc1 |
|---|
| InChI Key | AXOKTEBEHQJOEG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | retro-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl-phenylketonesamphetamines and derivativesaryl alkyl ketonesbenzoyl derivativesbutyrophenoneshydrocarbon derivativeslinear 1,3-diarylpropanoidsmonoalkylaminesorganic oxidesorganooxygen compoundsorganopnictogen compoundsvinylogous amides |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonebenzoylretro-dihydrochalconeketoneorganic oxideorganonitrogen compoundorganopnictogen compoundamphetamine or derivativesvinylogous amidephenylketonebutyrophenonearomatic homomonocyclic compoundorganic oxygen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineprimary amineorganic nitrogen compoundaminealkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
