| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:41 UTC |
|---|
| Update Date | 2025-03-21 18:31:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087660 |
|---|
| Frequency | 32.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15N4O8P |
|---|
| Molecular Mass | 338.0628 |
|---|
| SMILES | Nc1c(NC=O)ncn1C1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | NFNJTMYRMIZTHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazole ribonucleosides and ribonucleotidesimidazolesimidolactamsmonoalkyl phosphatesmonosaccharidesn-arylamidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminessecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | imidazole ribonucleosidecarbonyl grouparomatic heteromonocyclic compoundpentose phosphateamino acid or derivativespentose-5-phosphaten-arylamidecarboxylic acid derivativeorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amidephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphate |
|---|
