| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:42 UTC |
|---|
| Update Date | 2025-03-21 18:31:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087708 |
|---|
| Frequency | 32.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12O3 |
|---|
| Molecular Mass | 192.0786 |
|---|
| SMILES | Cc1ccc(C)c(CC(=O)C(=O)O)c1 |
|---|
| InChI Key | BHDFBDZCHVESTD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpyruvic acid derivatives |
|---|
| Direct Parent | phenylpyruvic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenylpropanoic acidsp-xylenes |
|---|
| Substituents | carbonyl groupcarboxylic acidphenylpyruvate3-phenylpropanoic-acidalpha-hydroxy ketonecarboxylic acid derivativeketonearomatic homomonocyclic compoundxyleneorganic oxidemonocarboxylic acid or derivativesp-xyleneorganic oxygen compoundketo acidalpha-keto acidhydrocarbon derivativeorganooxygen compound |
|---|
