| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:42 UTC |
|---|
| Update Date | 2025-03-21 18:31:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087715 |
|---|
| Frequency | 32.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C39H42FN3O10 |
|---|
| Molecular Mass | 731.2854 |
|---|
| SMILES | CC(C)c1c(C(=O)Nc2ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC(O)CC(=O)O |
|---|
| InChI Key | CDRKROQHMOIJLP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaromatic anilidesaryl fluoridesazacyclic compoundsbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsfluorobenzenesheteroaromatic compoundshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundspyrrole carboxamidessecondary alcoholssecondary carboxylic acid amidessubstituted pyrrolestricarboxylic acids and derivativesvinylogous amides |
|---|
| Substituents | aryl fluoridemonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundpyrrole-3-carboxylic acid or derivativesbenzoyltricarboxylic acid or derivativessubstituted pyrroleorganohalogen compoundbenzamidearomatic anilidebeta-hydroxy acidfluorobenzeneorganic oxideorganonitrogen compoundpyrrole-3-carboxamidealpha-amino acidorganopnictogen compoundorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesalcoholvinylogous amideazacyclen-acyl-alpha-amino acidorganofluoridehippuric acid or derivativesheteroaromatic compoundbenzoic acid or derivativesglutamic acid or derivativeshydroxy acidcarboxamide grouparyl halidesecondary carboxylic acid amideorganic oxygen compoundpyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
