| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:44 UTC |
|---|
| Update Date | 2025-03-21 18:31:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087778 |
|---|
| Frequency | 32.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O9S |
|---|
| Molecular Mass | 270.0046 |
|---|
| SMILES | O=C1CC(O)=C(OS(=O)(=O)O)C(C(O)CO)O1 |
|---|
| InChI Key | FKSBPHNOGZNISC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | dihydropyranones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundscarboxylic acid estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholsulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativesdihydropyranonecarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterprimary alcoholorganooxygen compound1,2-diol |
|---|