| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:46 UTC |
|---|
| Update Date | 2025-03-21 18:31:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087857 |
|---|
| Frequency | 32.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C3HCl5O2 |
|---|
| Molecular Mass | 243.8419 |
|---|
| SMILES | O=C(O)C(Cl)(Cl)C(Cl)(Cl)Cl |
|---|
| InChI Key | MTVIFDMVZHUZOV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | alpha-halocarboxylic acids and derivatives |
|---|
| Direct Parent | alpha-halocarboxylic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chloridescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochlorides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidalkyl chlorideorganochloridealpha-halocarboxylic acidorganohalogen compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|