| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:10:48 UTC |
|---|
| Update Date | 2025-03-21 18:31:51 UTC |
|---|
| HMDB ID | HMDB0134095 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087946 |
|---|
| Name | 6-{[3-(2,5-dihydroxyphenyl)prop-2-enoyl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Frequency | 32.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16O10 |
|---|
| Molecular Mass | 356.0743 |
|---|
| SMILES | O=C(C=Cc1cc(O)ccc1O)OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | MQXNCKSLVCDBBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesenoate estersfatty acid estersglucuronic acid derivativeshydrocarbon derivativeshydroquinoneshydroxycinnamic acidsmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativepyran carboxylic acidhydroxycinnamic acid or derivatives1-o-glucuronidealpha,beta-unsaturated carboxylic estercinnamic acid or derivativesbeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundenoate esteralcoholpyran carboxylic acid or derivativeshydroxy acidhydroxycinnamic acidhydroquinoneoxacyclefatty acid esterpyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoid |
|---|
