| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:49 UTC |
|---|
| Update Date | 2025-03-21 18:31:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00087965 |
|---|
| Frequency | 32.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O6 |
|---|
| Molecular Mass | 286.0477 |
|---|
| SMILES | O=c1oc2cc(O)ccc2c(O)c1-c1ccc(O)c(O)c1 |
|---|
| InChI Key | HRLOVDCTTGTDPD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-3-enes |
|---|
| Direct Parent | isoflav-3-enones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4-hydroxycoumarins7-hydroxycoumarinsbenzene and substituted derivativescoumarins and derivativesheteroaromatic compoundshydrocarbon derivativesisoflavonoidslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidisoflav-3-enone skeletonlactoneorganic oxidearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compound4-hydroxycoumarinbenzopyran7-hydroxycoumarinheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidcoumarinoxacyclevinylogous acidorganic oxygen compoundpyranphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|