| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:51 UTC |
|---|
| Update Date | 2025-03-21 18:31:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088042 |
|---|
| Frequency | 32.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O9S |
|---|
| Molecular Mass | 270.0046 |
|---|
| SMILES | O=C1CC(O)(C(=O)O)CC(O)C1OS(=O)(=O)O |
|---|
| InChI Key | LEDQVHBWNQSCMH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesalpha hydroxy acids and derivativescarboxylic acidscyclic ketonescyclitols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholsulfuric acid monoestercarbonyl groupcarboxylic acidalpha-hydroxy acidcyclitol or derivativescyclic ketonehydroxy acidcyclic alcoholcarboxylic acid derivativeketonetertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl sulfatesecondary alcoholaliphatic homomonocyclic compoundsulfate-esterhydrocarbon derivativeorganooxygen compound |
|---|