| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:51 UTC |
|---|
| Update Date | 2025-03-21 18:31:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088063 |
|---|
| Frequency | 32.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14O7 |
|---|
| Molecular Mass | 270.074 |
|---|
| SMILES | O=C1OC(Cc2ccc(O)c(O)c2)C(O)C(O)C1O |
|---|
| InChI Key | CIKQOCPBPSRZGL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | gluconolactones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersdelta valerolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compounddelta valerolactone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactoneorganic oxidegluconolactoneoxanedelta_valerolactoneorganoheterocyclic compoundalcohol1-hydroxy-4-unsubstituted benzenoidoxacyclemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoid |
|---|