| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:10:52 UTC |
|---|
| Update Date | 2025-03-21 18:31:53 UTC |
|---|
| HMDB ID | HMDB0125363 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088088 |
|---|
| Name | 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propane-1,2-dione |
|---|
| Frequency | 32.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O6 |
|---|
| Molecular Mass | 288.0634 |
|---|
| SMILES | O=C(Cc1ccc(O)cc1)C(=O)c1c(O)cc(O)cc1O |
|---|
| InChI Key | UAXKKOUIRYHGCN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalpha-diketonesaryl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesorganic oxidesvinylogous acids |
|---|
| Substituents | acylphloroglucinol derivativemonocyclic benzene moietycarbonyl group2'-hydroxy-dihydrochalconebenzenetriolbenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenol1-hydroxy-4-unsubstituted benzenoidalpha-diketoneketonebutyrophenonephloroglucinol derivativearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
