| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:10:53 UTC |
|---|
| Update Date | 2025-03-21 18:31:54 UTC |
|---|
| HMDB ID | HMDB0059975 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088121 |
|---|
| Name | 4-Hydroxy-5-(3'-hydroxyphenyl)-valeric acid-3'-O-sulphate |
|---|
| Frequency | 32.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O7S |
|---|
| Molecular Mass | 290.046 |
|---|
| SMILES | O=C(O)CCC(O)Cc1cccc(OS(=O)(=O)O)c1 |
|---|
| InChI Key | DMBFBGLRQKIWGT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | sulfated fatty acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbocyclic fatty acidscarbonyl compoundscarboxylic acidshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylsulfatessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | carbocyclic fatty acidmonocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acidcarboxylic acid derivativemedium-chain hydroxy acidphenylsulfateorganic oxidemedium-chain fatty acidhydroxy fatty acidarylsulfatealcoholorganic sulfuric acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundsulfated fatty acidsecondary alcoholsulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|