| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:10:55 UTC |
|---|
| Update Date | 2025-03-21 18:31:54 UTC |
|---|
| HMDB ID | HMDB0128460 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088212 |
|---|
| Name | 5,13-dihydroxy-14-methoxy-8,17-dioxatetracyclo[8.7.0.0²,⁷.0¹¹,¹⁶]heptadeca-1(10),2(7),3,5,11,13,15-heptaen-9-one |
|---|
| Frequency | 32.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H10O6 |
|---|
| Molecular Mass | 298.0477 |
|---|
| SMILES | COc1cc2oc3c4ccc(O)cc4oc(=O)c3c2cc1O |
|---|
| InChI Key | ATSGDNORCPKOGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | coumestans |
|---|
| Direct Parent | coumestans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersangular furanocoumarinsanisolesbenzofuransfuransfuropyransheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | furanphenol etherether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherlactoneorganic oxidearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundfuranocoumarinbenzopyranbenzofuranheteroaromatic compoundfuropyrancoumarinangular furanocoumarinoxacycleorganic oxygen compoundpyrananisolecoumestanhydrocarbon derivativebenzenoidorganooxygen compound |
|---|