| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:55 UTC |
|---|
| Update Date | 2025-03-21 18:31:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088229 |
|---|
| Frequency | 71.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N6O |
|---|
| Molecular Mass | 220.1073 |
|---|
| SMILES | CN(C)Cc1cnc2nc(N)[nH]c(=O)c2n1 |
|---|
| InChI Key | PKEWVVCHDNPEGS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aralkylaminesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidonestrialkylamines |
|---|
| Substituents | pterinlactamazacycleheteroaromatic compoundtertiary aliphatic aminepyrimidonearalkylaminepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
