| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:10:55 UTC |
|---|
| Update Date | 2025-03-21 18:31:55 UTC |
|---|
| HMDB ID | HMDB0015169 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088236 |
|---|
| Name | Procainamide |
|---|
| Frequency | 32.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H21N3O |
|---|
| Molecular Mass | 235.1685 |
|---|
| SMILES | CCN(CC)CCNC(=O)c1ccc(N)cc1 |
|---|
| InChI Key | REQCZEXYDRLIBE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminessecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | amino acid or derivativestertiary aliphatic aminebenzoylcarboxamide groupcarboxylic acid derivativebenzamidearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
