| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:57 UTC |
|---|
| Update Date | 2025-03-21 18:31:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088289 |
|---|
| Frequency | 32.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17NO9 |
|---|
| Molecular Mass | 355.0903 |
|---|
| SMILES | O=C(O)C1Cc2cc(OC3OC(C(=O)O)C(O)C(O)C3O)ccc2N1 |
|---|
| InChI Key | PSAXXBXXQKAYPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalpha amino acidsamino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesindolecarboxylic acidsindolesindolinesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol etherspyran carboxylic acidssecondary alcoholssecondary alkylarylamines |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidamino acid or derivativesamino acidindoleo-glucuronidemonosaccharidealpha-amino acid or derivativescarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxanedihydroindoleorganoheterocyclic compoundindolecarboxylic acid derivativealcoholpyran carboxylic acid or derivativesazacycleindole or derivativeshydroxy acidsecondary aminesecondary aliphatic/aromatic amineoxacyclepyranindolecarboxylic acidsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundamine |
|---|
