| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:59 UTC |
|---|
| Update Date | 2025-03-21 18:31:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088366 |
|---|
| Frequency | 32.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H32O17 |
|---|
| Molecular Mass | 532.164 |
|---|
| SMILES | O=C(O)C1(OCC2OC(OC3(CO)OC(CO)C(O)C3O)C(O)C(O)C2O)CC(O)C(O)C(CO)O1 |
|---|
| InChI Key | VJFAQAJIVLVVQW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidpyran carboxylic acid or derivativestetrahydrofuranmonosaccharidecarboxylic acid derivativeoxacyclesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundacetalketalaliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganooxygen compound |
|---|