| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:59 UTC |
|---|
| Update Date | 2025-03-21 18:31:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088378 |
|---|
| Frequency | 32.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16O5 |
|---|
| Molecular Mass | 276.0998 |
|---|
| SMILES | Oc1cc(O)cc(CC(O)Cc2ccc(O)c(O)c2)c1 |
|---|
| InChI Key | WQWCZLOZIYSQSX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | cinnamylphenols |
|---|
| Direct Parent | cinnamylphenols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesresorcinolssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoidcinnamylphenol1-hydroxy-4-unsubstituted benzenoidresorcinolaromatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|